Difference between revisions of "L-methionyl-L-asparaginyl-Protein"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * common name: ** le...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-asparaginyl-Protein L-methionyl-L-asparaginyl-Protein] == * common name: ** an N-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-asparaginyl-Protein L-methionyl-L-asparaginyl-Protein] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an N-terminal-L-methionyl-L-asparaginyl-[protein] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an L-methionyl-L-asparaginyl-[protein] |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17850]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an N-terminal-L-methionyl-L-asparaginyl-[protein]}} | |
| − | + | {{#set: common name=an L-methionyl-L-asparaginyl-[protein]}} | |
| − | + | {{#set: consumed by=RXN-17850}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: consumed by=RXN- | + | |
| − | + | ||
Latest revision as of 19:45, 21 March 2018
Contents
Metabolite L-methionyl-L-asparaginyl-Protein
- common name:
- an N-terminal-L-methionyl-L-asparaginyl-[protein]
- Synonym(s):
- an L-methionyl-L-asparaginyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an N-terminal-L-methionyl-L-asparaginyl-[protein" cannot be used as a page name in this wiki.
"an L-methionyl-L-asparaginyl-[protein" cannot be used as a page name in this wiki.
