Difference between revisions of "Tiso gene 2777"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * common name: ** (2S,4...") |
(Created page with "Category:Gene == Gene Tiso_gene_2777 == * Synonym(s): == Reactions associated == * Reaction: 3.4.21.4-RXN ** Source: orthology-esiliculosus == Pathways associated...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2777 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN | + | * Reaction: [[3.4.21.4-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.4.21.4-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:50, 21 March 2018
Gene Tiso_gene_2777
- Synonym(s):
Reactions associated
- Reaction: 3.4.21.4-RXN
- Source: orthology-esiliculosus