Difference between revisions of "CPD-294"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phospholipid-Olefinic-Fatty-Acids Phospholipid-Olefinic-Fatty-Acids] == * common name: ** a [ph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] == * smiles: ** C(=CC(=O)[O-])C(=O)CC([O-])=O * common name: ** 2-maleylacetat...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] == |
| + | * smiles: | ||
| + | ** C(=CC(=O)[O-])C(=O)CC([O-])=O | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-maleylacetate |
| + | * inchi key: | ||
| + | ** InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L | ||
| + | * molecular weight: | ||
| + | ** 156.095 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-oxohex-2-enedioate | ||
| + | ** maleylacetate | ||
| + | ** (2Z)-4-oxohex-2-enedioate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9868]] | ||
| + | * [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-9922]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543165 9543165] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.7822138.html 7822138] | ||
| + | * UM-BBD-CPD : c0099 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16468 16468] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02222 C02222] | ||
| + | {{#set: smiles=C(=CC(=O)[O-])C(=O)CC([O-])=O}} | ||
| + | {{#set: common name=2-maleylacetate}} | ||
| + | {{#set: inchi key=InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L}} | ||
| + | {{#set: molecular weight=156.095 }} | ||
| + | {{#set: common name=4-oxohex-2-enedioate|maleylacetate|(2Z)-4-oxohex-2-enedioate}} | ||
| + | {{#set: produced by=RXN-9868|CARBOXYMETHYLENEBUTENOLIDASE-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-9922}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-294
- smiles:
- C(=CC(=O)[O-])C(=O)CC([O-])=O
- common name:
- 2-maleylacetate
- inchi key:
- InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L
- molecular weight:
- 156.095
- Synonym(s):
- 4-oxohex-2-enedioate
- maleylacetate
- (2Z)-4-oxohex-2-enedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(=O)CC([O-])=O" cannot be used as a page name in this wiki.
