Difference between revisions of "Tiso gene 12579"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * common name: ** (S)-...") |
(Created page with "Category:Gene == Gene Tiso_gene_12579 == * right end position: ** 5074 * transcription direction: ** NEGATIVE * left end position: ** 3591 * centisome position: ** 52.3469...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12579 == |
− | * | + | * right end position: |
− | ** | + | ** 5074 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 3591 |
− | * | + | * centisome position: |
− | ** | + | ** 52.34694 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.11.2-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * | + | ** Source: [[orthology-esiliculosus]] |
− | + | == Pathways associated == | |
− | * [[ | + | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5074}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=3591}} | |
− | + | {{#set: centisome position=52.34694 }} | |
− | + | {{#set: reaction associated=2.7.11.2-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:54, 21 March 2018
Gene Tiso_gene_12579
- right end position:
- 5074
- transcription direction:
- NEGATIVE
- left end position:
- 3591
- centisome position:
- 52.34694
- Synonym(s):
Reactions associated
- Reaction: 2.7.11.2-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation