Difference between revisions of "RNA-Ligase-L-lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] == * smiles: ** C1(=C(NC=N1)CC[N+]) * common name: ** histamine * inchi ke...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-Ligase-L-lysine RNA-Ligase-L-lysine] == * common name: ** an [RNA ligase]-L-lysine * Synony...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-Ligase-L-lysine RNA-Ligase-L-lysine] ==
* smiles:
+
** C1(=C(NC=N1)CC[N+])
+
 
* common name:
 
* common name:
** histamine
+
** an [RNA ligase]-L-lysine
* inchi key:
+
** InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O
+
* molecular weight:
+
** 112.154   
+
 
* Synonym(s):
 
* Synonym(s):
** peremin
 
** 1H-Imidazole-4-ethanamine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9600]]
+
* [[RXN-17925]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17926]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 51-45-6
+
{{#set: common name=an [RNA ligase]-L-lysine}}
* PUBCHEM:
+
{{#set: consumed by=RXN-17925}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201573 25201573]
+
{{#set: produced by=RXN-17926}}
* HMDB : HMDB00870
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00388 C00388]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58432 58432]
+
* METABOLIGHTS : MTBLC58432
+
{{#set: smiles=C1(=C(NC=N1)CC[N+])}}
+
{{#set: common name=histamine}}
+
{{#set: inchi key=InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O}}
+
{{#set: molecular weight=112.154    }}
+
{{#set: common name=peremin|1H-Imidazole-4-ethanamine}}
+
{{#set: consumed by=RXN-9600}}
+

Latest revision as of 19:57, 21 March 2018

Metabolite RNA-Ligase-L-lysine

  • common name:
    • an [RNA ligase]-L-lysine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [RNA ligase]-L-lysine" cannot be used as a page name in this wiki.