Difference between revisions of "Tiso gene 17798"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ma...")
(Created page with "Category:Gene == Gene Tiso_gene_17798 == * right end position: ** 2318 * transcription direction: ** POSITIVE * left end position: ** 721 * centisome position: ** 20.88644...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] ==
+
== Gene Tiso_gene_17798 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)C(O)C(O)C(O)C(O)CO
+
** 2318
−
* common name:
+
* transcription direction:
−
** aldehydo-D-mannose
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
+
** 721
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 20.886442    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14501]]
+
* Reaction: [[RXN-10058]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
−
* [[1.1.1.255-RXN]]
+
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
* [[RXN-14500]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6167]]
 +
* [[PWY-6168]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2318}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161658 161658]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=721}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675]
+
{{#set: centisome position=20.886442   }}
−
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}}
+
{{#set: reaction associated=RXN-10058|TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
−
{{#set: common name=aldehydo-D-mannose}}
+
{{#set: pathway associated=PWY-6167|PWY-6168}}
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}}
+
−
{{#set: molecular weight=180.157   }}
+
−
{{#set: consumed by=RXN-14501}}
+
−
{{#set: reversible reaction associated=1.1.1.255-RXN|RXN-14500}}
+

Latest revision as of 20:01, 21 March 2018

Gene Tiso_gene_17798

  • right end position:
    • 2318
  • transcription direction:
    • POSITIVE
  • left end position:
    • 721
  • centisome position:
    • 20.886442
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17798&oldid=45323"