Difference between revisions of "Tiso gene 15144"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17386 CPD-17386] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(...")
(Created page with "Category:Gene == Gene Tiso_gene_15144 == * right end position: ** 4970 * transcription direction: ** NEGATIVE * left end position: ** 46 * centisome position: ** 0.8834261...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17386 CPD-17386] ==
+
== Gene Tiso_gene_15144 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 4970
−
* common name:
+
* transcription direction:
−
** (2E,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosaheptaenoyl-CoA
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=NVOWZIBKQIWTDG-ADUCOSNASA-J
+
** 46
−
* molecular weight:
+
* centisome position:
−
** 1100.019    
+
** 0.88342613    
 
* Synonym(s):
 
* Synonym(s):
−
** (2E,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-2,6,9,12,15,18,21-heptaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16135]]
+
* Reaction: [[PYRUVATE-CARBOXYLASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-16134]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6142]]
 +
* [[PWY-6146]]
 +
* [[P42-PWY]]
 +
* [[PWY-5750]]
 +
* [[PWY66-399]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4970}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193705 72193705]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=46}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76360 76360]
+
{{#set: centisome position=0.88342613   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=PYRUVATE-CARBOXYLASE-RXN}}
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosaheptaenoyl-CoA}}
+
{{#set: pathway associated=PWY-6142|PWY-6146|P42-PWY|PWY-5750|PWY66-399}}
−
{{#set: inchi key=InChIKey=NVOWZIBKQIWTDG-ADUCOSNASA-J}}
+
−
{{#set: molecular weight=1100.019   }}
+
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-2,6,9,12,15,18,21-heptaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16135}}
+
−
{{#set: produced by=RXN-16134}}
+

Latest revision as of 20:02, 21 March 2018

Gene Tiso_gene_15144

  • right end position:
    • 4970
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 46
  • centisome position:
    • 0.88342613
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15144&oldid=45430"