Difference between revisions of "CPD-14378"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_NA+ TransportSeed_NA+] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Fo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == * smiles: ** C([N+])CC[N+]=CCCC[N+] * common name: ** dehydrospermidine...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([N+])CC[N+]=CCCC[N+] |
| + | * common name: | ||
| + | ** dehydrospermidine | ||
| + | * inchi key: | ||
| + | ** InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q | ||
| + | * molecular weight: | ||
| + | ** 146.255 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-13415]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13414]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266746 45266746] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58732 58732] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC58732 |
| + | {{#set: smiles=C([N+])CC[N+]=CCCC[N+]}} | ||
| + | {{#set: common name=dehydrospermidine}} | ||
| + | {{#set: inchi key=InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q}} | ||
| + | {{#set: molecular weight=146.255 }} | ||
| + | {{#set: consumed by=RXN-13415}} | ||
| + | {{#set: produced by=RXN-13414}} | ||
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite CPD-14378
- smiles:
- C([N+])CC[N+]=CCCC[N+]
- common name:
- dehydrospermidine
- inchi key:
- InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
- molecular weight:
- 146.255
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])CC[N+]=CCCC[N+" cannot be used as a page name in this wiki.
