Difference between revisions of "CPD-31"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14906 RXN-14906] == * direction: ** REVERSIBLE * common name: ** ORF * ec number: ** [http://en...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * smiles: ** CC(O)(C(=O)[O-])CC(=O)[O-] * common name: ** (R)-citramalate * i...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14906 RXN-14906] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(O)(C(=O)[O-])CC(=O)[O-]
 
* common name:
 
* common name:
−
** ORF
+
** (R)-citramalate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.11.11 EC-2.7.11.11]
+
** InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L
−
** [http://enzyme.expasy.org/EC/2.7.12.1 EC-2.7.12.1]
+
* molecular weight:
 +
** 146.099   
 
* Synonym(s):
 
* Synonym(s):
 +
** (R)-2-methylmalic acid
 +
** (3R)-citramalate
 +
** (3R)-citramalic acid
 +
** (3R)-α-hydroxypyrotartaric acid
 +
** D-citramalate
 +
** D-citramalic acid
 +
** D-α-hydroxypyrotartaric acid
 +
** (R)-2-methylmalate
 +
** (R)-(-)-citramalic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[Proteins-L-Threonines]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[Protein-Phosphothreonines]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-7743]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 a [protein]-L-threonine[c] '''<=>''' 1 ADP[c] '''+''' 1 a [protein] L-threonine phosphate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_1810]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* CAS : 6236-10-8
−
{{#set: common name=ORF}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.7.11.11}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460281 5460281]
−
{{#set: ec number=EC-2.7.12.1}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_1810}}
+
** [http://www.chemspider.com/Chemical-Structure.4573870.html 4573870]
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30934 30934]
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02612 C02612]
 +
{{#set: smiles=CC(O)(C(=O)[O-])CC(=O)[O-]}}
 +
{{#set: common name=(R)-citramalate}}
 +
{{#set: inchi key=InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L}}
 +
{{#set: molecular weight=146.099    }}
 +
{{#set: common name=(R)-2-methylmalic acid|(3R)-citramalate|(3R)-citramalic acid|(3R)-&alpha;-hydroxypyrotartaric acid|D-citramalate|D-citramalic acid|D-&alpha;-hydroxypyrotartaric acid|(R)-2-methylmalate|(R)-(-)-citramalic acid}}
 +
{{#set: produced by=RXN-7743}}

Latest revision as of 20:06, 21 March 2018

Metabolite CPD-31

  • smiles:
    • CC(O)(C(=O)[O-])CC(=O)[O-]
  • common name:
    • (R)-citramalate
  • inchi key:
    • InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L
  • molecular weight:
    • 146.099
  • Synonym(s):
    • (R)-2-methylmalic acid
    • (3R)-citramalate
    • (3R)-citramalic acid
    • (3R)-α-hydroxypyrotartaric acid
    • D-citramalate
    • D-citramalic acid
    • D-α-hydroxypyrotartaric acid
    • (R)-2-methylmalate
    • (R)-(-)-citramalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)(C(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-31&oldid=45968"