Difference between revisions of "RXN0-1133"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * common name: ** dethi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1133 RXN0-1133] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrolipoamide_acetyltran...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1133 RXN0-1133] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** dihydrolipoamide_acetyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.12 EC-2.3.1.12] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ACETYL-COA]][c] '''+''' 1 [[Pyruvate-dehydrogenase-dihydrolipoate]][c] '''=>''' 1 [[Pyruvate-dehydrogenase-acetylDHlipoyl]][c] '''+''' 1 [[CO-A]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 acetyl-CoA[c] '''+''' 1 a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine[c] '''=>''' 1 a [pyruvate dehydrogenase E2 protein] N6-S-acetyldihydrolipoyl-L-lysine[c] '''+''' 1 coenzyme A[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_19780]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_2693]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PYRUVDEHYD-PWY]], pyruvate decarboxylation to acetyl CoA: [http://metacyc.org/META/NEW-IMAGE?object=PYRUVDEHYD-PWY PYRUVDEHYD-PWY] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02569 R02569] |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q01991 Q01991] |
− | * | + | ** [http://www.uniprot.org/uniprot/P12695 P12695] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q7M2M8 Q7M2M8] |
− | * | + | ** [http://www.uniprot.org/uniprot/P10515 P10515] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q39082 Q39082] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9TRP7 Q9TRP7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M0X6 Q7M0X6] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q59098 Q59098] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PF09 Q9PF09] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P35489 P35489] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P21883 P21883] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q59658 Q59658] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JU07 Q9JU07] |
+ | ** [http://www.uniprot.org/uniprot/Q59298 Q59298] | ||
+ | ** [http://www.uniprot.org/uniprot/P45118 P45118] | ||
+ | ** [http://www.uniprot.org/uniprot/Q54102 Q54102] | ||
+ | ** [http://www.uniprot.org/uniprot/P11961 P11961] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59821 Q59821] | ||
+ | ** [http://www.uniprot.org/uniprot/P08461 P08461] | ||
+ | ** [http://www.uniprot.org/uniprot/Q16791 Q16791] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41737 Q41737] | ||
+ | ** [http://www.uniprot.org/uniprot/O64968 O64968] | ||
+ | ** [http://www.uniprot.org/uniprot/P10802 P10802] | ||
+ | ** [http://www.uniprot.org/uniprot/P06959 P06959] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=dihydrolipoamide_acetyltransferase}} | ||
+ | {{#set: ec number=EC-2.3.1.12}} | ||
+ | {{#set: gene associated=Tiso_gene_19780|Tiso_gene_2693}} | ||
+ | {{#set: in pathway=PYRUVDEHYD-PWY}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:11, 21 March 2018
Contents
Reaction RXN0-1133
- direction:
- LEFT-TO-RIGHT
- common name:
- dihydrolipoamide_acetyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACETYL-COA[c] + 1 Pyruvate-dehydrogenase-dihydrolipoate[c] => 1 Pyruvate-dehydrogenase-acetylDHlipoyl[c] + 1 CO-A[c]
- With common name(s):
- 1 acetyl-CoA[c] + 1 a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine[c] => 1 a [pyruvate dehydrogenase E2 protein] N6-S-acetyldihydrolipoyl-L-lysine[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19780
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2693
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PYRUVDEHYD-PWY, pyruvate decarboxylation to acetyl CoA: PYRUVDEHYD-PWY
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
- UNIPROT: