Difference between revisions of "RXN-11832"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] == * smiles: ** C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11832 RXN-11832] == * direction: ** LEFT-TO-RIGHT * common name: ** ump-cmp_kinase ** cytidylat...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11832 RXN-11832] ==
−
* smiles:
+
* direction:
−
** C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 10-formyl-tetrahydrofolate mono-L-glutamate
+
** ump-cmp_kinase
−
* inchi key:
+
** cytidylate_kinase
−
** InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.7.4.14 EC-2.7.4.14]
−
** 471.429   
+
** [http://enzyme.expasy.org/EC/2.7.4.25 EC-2.7.4.25]
 
* Synonym(s):
 
* Synonym(s):
−
** N10-formyl-tetrahydrofolate mono-L-glutamate
 
−
** N10-formyl-THF mono-L-glutamate
 
−
** N10-formyl-H4F mono-L-glutamate
 
−
** 10-formyl-THF mono-L-glutamate
 
−
** 10-formyl-H4PteGlu1
 
−
** N10-formyl-H4PteGlu1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[FTHFO]]
+
* With identifiers:
−
* [[MTHFCx]]
+
** 1 [[CMP]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CDP]][c]
−
* [[R04560]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 CMP[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 CDP[c]
−
* [[FTHFL]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[FPGFTm]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[R01655]]
+
* Gene: [[Tiso_gene_19734]]
−
* [[FPAIF]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14116]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9739]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2386]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7205]], CMP phosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7205 PWY-7205]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2800-34-2
+
* RHEA:
−
* BIGG : 10fthf
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11600 11600]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878370 46878370]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00512 R00512]
−
* HMDB : HMDB00972
+
* UNIPROT:
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/O59845 O59845]
−
** [http://www.genome.jp/dbget-bin/www_bget?C00234 C00234]
+
** [http://www.uniprot.org/uniprot/Q29561 Q29561]
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/P43892 P43892]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57454 57454]
+
** [http://www.uniprot.org/uniprot/Q58071 Q58071]
−
* METABOLIGHTS : MTBLC57454
+
** [http://www.uniprot.org/uniprot/Q9CEY1 Q9CEY1]
−
{{#set: smiles=C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))}}
+
** [http://www.uniprot.org/uniprot/P57064 P57064]
−
{{#set: common name=10-formyl-tetrahydrofolate mono-L-glutamate}}
+
** [http://www.uniprot.org/uniprot/P0A6I0 P0A6I0]
−
{{#set: inchi key=InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L}}
+
** [http://www.uniprot.org/uniprot/P47572 P47572]
−
{{#set: molecular weight=471.429    }}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=N10-formyl-tetrahydrofolate mono-L-glutamate|N10-formyl-THF mono-L-glutamate|N10-formyl-H4F mono-L-glutamate|10-formyl-THF mono-L-glutamate|10-formyl-H4PteGlu1|N10-formyl-H4PteGlu1}}
+
{{#set: common name=ump-cmp_kinase}}
−
{{#set: consumed by=FTHFO|MTHFCx|R04560}}
+
{{#set: common name=cytidylate_kinase}}
−
{{#set: produced by=FTHFL}}
+
{{#set: ec number=EC-2.7.4.14}}
−
{{#set: reversible reaction associated=FPGFTm|R01655|FPAIF}}
+
{{#set: ec number=EC-2.7.4.25}}
 +
{{#set: gene associated=Tiso_gene_19734|Tiso_gene_14116|Tiso_gene_9739|Tiso_gene_2386}}
 +
{{#set: in pathway=PWY-7205}}
 +
{{#set: reconstruction category=orthology|manual|annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|manual-primary_network|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:11, 21 March 2018

Reaction RXN-11832

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ump-cmp_kinase
    • cytidylate_kinase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 CMP[c] + 1 ATP[c] => 1 ADP[c] + 1 CDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7205, CMP phosphorylation: PWY-7205
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11832&oldid=46694"