Difference between revisions of "DCTUP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == * smiles: ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] * common name:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTUP DCTUP] == * direction: ** LEFT-TO-RIGHT * common name: ** dCTP:uridine 5'-phosphotransferase...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTUP DCTUP] ==
−
* smiles:
+
* direction:
−
** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** (R)-mevalonate diphosphate
+
** dCTP:uridine 5'-phosphotransferase
−
* inchi key:
+
−
** InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J
+
−
* molecular weight:
+
−
** 304.087   
+
 
* Synonym(s):
 
* Synonym(s):
−
** mevalonate-5-PP
 
−
** (R)-5-diphosphomevalonate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[DCTP]][c] '''+''' 1.0 [[URIDINE]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[UMP]][c] '''+''' 1.0 [[DCDP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 dCTP[c] '''+''' 1.0 uridine[c] '''=>''' 1.0 H+[c] '''+''' 1.0 UMP[c] '''+''' 1.0 dCDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 4872-34-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=dCTP:uridine 5'-phosphotransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916915 24916915]
+
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
−
* HMDB : HMDB01090
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57557 57557]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01143 C01143]
+
−
{{#set: smiles=CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]}}
+
−
{{#set: common name=(R)-mevalonate diphosphate}}
+
−
{{#set: inchi key=InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J}}
+
−
{{#set: molecular weight=304.087    }}
+
−
{{#set: common name=mevalonate-5-PP|(R)-5-diphosphomevalonate}}
+
−
{{#set: consumed by=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN}}
+

Latest revision as of 20:12, 21 March 2018

Reaction DCTUP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dCTP:uridine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 dCTP[c] + 1.0 uridine[c] => 1.0 H+[c] + 1.0 UMP[c] + 1.0 dCDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DCTUP&oldid=46861"