Difference between revisions of "FA160COAabcp"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FA160COAabcp FA160COAabcp] == * direction: ** LEFT-TO-RIGHT * common name: ** fatty acyl-CoA peroxi...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FA160COAabcp FA160COAabcp] ==
−
* smiles:
+
* direction:
−
** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** echinenone
+
** fatty acyl-CoA peroxisomal transport via ABC system (16:0)
−
* inchi key:
+
−
** InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N
+
−
* molecular weight:
+
−
** 550.866   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[R07562]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PALMITYL-COA]][c] '''+''' 1.0 [[ATP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[PALMITYL-COA]][x] '''+''' 1.0 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 palmitoyl-CoA[c] '''+''' 1.0 ATP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 H+[c] '''+''' 1.0 palmitoyl-CoA[x] '''+''' 1.0 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18007]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR01070060
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=fatty acyl-CoA peroxisomal transport via ABC system (16:0)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281236 5281236]
+
{{#set: gene associated=Tiso_gene_18007}}
−
* CHEMSPIDER:
+
{{#set: in pathway=}}
−
** [http://www.chemspider.com/Chemical-Structure.4444648.html 4444648]
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4746 4746]
+
{{#set: reconstruction tool=pantograph}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C08592 C08592]
+
−
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}}
+
−
{{#set: common name=echinenone}}
+
−
{{#set: inchi key=InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N}}
+
−
{{#set: molecular weight=550.866    }}
+
−
{{#set: consumed by=R07562}}
+

Latest revision as of 20:22, 21 March 2018

Reaction FA160COAabcp

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • fatty acyl-CoA peroxisomal transport via ABC system (16:0)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 palmitoyl-CoA[c] + 1.0 ATP[c] + 1.0 H2O[c] => 1.0 ADP[c] + 1.0 H+[c] + 1.0 palmitoyl-CoA[x] + 1.0 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=FA160COAabcp&oldid=48257"