Difference between revisions of "PWY-2541"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_18334 == * left end position: ** 339 * transcription direction: ** NEGATIVE * right end position: ** 3072 * centisome position: ** 10.98509...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18334 == |
− | * | + | * left end position: |
− | ** | + | ** 339 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3072 |
− | * | + | * centisome position: |
− | ** | + | ** 10.985094 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[2.7.12.2-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***automated-name-match |
− | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
− | * [[RXN- | + | ** [[pantograph]]-[[esiliculosus]] |
− | + | * [[RXN-16317]] | |
− | * | + | ** in-silico_annotation |
− | * | + | ***automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=339}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3072}} | |
− | + | {{#set: centisome position=10.985094 }} | |
− | + | {{#set: reaction associated=2.7.12.2-RXN|PROTEIN-KINASE-RXN|RXN-16317}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:35, 10 January 2018
Gene Tiso_gene_18334
- left end position:
- 339
- transcription direction:
- NEGATIVE
- right end position:
- 3072
- centisome position:
- 10.985094
- Synonym(s):
Reactions associated
- 2.7.12.2-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- PROTEIN-KINASE-RXN
- RXN-16317
- in-silico_annotation
- automated-name-match
- in-silico_annotation