Difference between revisions of "Tiso gene 19489"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16101 RXN-16101] == * direction: ** LEFT-TO-RIGHT * common name: ** delta-8_desaturase * ec num...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16101 RXN-16101] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
+
 
* common name:
 
* common name:
−
** 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
+
** delta-8_desaturase
−
* molecular weight:
+
* ec number:
−
** 821.32   
+
** [http://enzyme.expasy.org/EC/1.14.19.4 EC-1.14.19.4]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-9235]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 2 [[PROTON]][c] '''+''' 1 [[CPD-17352]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[CPD-17281]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 H+[c] '''+''' 1 a [glycerolipid]-(11Z,14Z,17Z)-icosatrienoate[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 oxygen[c] '''=>''' 2 H2O[c] '''+''' 1 a [glycerolipid]-icosatetraenoate[c] '''+''' 2 a ferricytochrome b5[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_5024]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7602]], icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7602 PWY-7602]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986248 50986248]
+
{{#set: common name=delta-8_desaturase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.14.19.4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180]
+
{{#set: gene associated=Tiso_gene_5024}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}}
+
{{#set: in pathway=PWY-7602}}
−
{{#set: inchi key=InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=821.32    }}
+
{{#set: reconstruction source=in-silico_annotation}}
−
{{#set: common name=2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol}}
+
−
{{#set: consumed by=RXN-9235}}
+

Revision as of 15:36, 10 January 2018

Reaction RXN-16101

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • delta-8_desaturase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7602, icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): PWY-7602
    • 7 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19489&oldid=9724"