Difference between revisions of "RXN-14192"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14192 RXN-14192] == * direction: ** REVERSIBLE * common name: ** pyruvate_kinase * ec number: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] == * smiles: ** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N) |
| + | * inchi key: | ||
| + | ** InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** preQ0 |
| − | * | + | * molecular weight: |
| − | ** | + | ** 175.149 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 7-cyano-7-deazaguanine | ||
| + | ** 7-cyano-7-carbaguanine | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12093]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * DRUGBANK : DB03074 |
| − | ** [http://www.ebi.ac.uk/ | + | * PUBCHEM: |
| − | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=446357 446357] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.393739.html 393739] |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45075 45075] | |
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15996 C15996] | |
| − | + | {{#set: smiles=C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)}} | |
| − | {{#set: | + | {{#set: inchi key=InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: common name=preQ0}} |
| − | {{#set: | + | {{#set: molecular weight=175.149 }} |
| − | {{#set: | + | {{#set: common name=7-cyano-7-deazaguanine|7-cyano-7-carbaguanine}} |
| − | {{#set: | + | {{#set: produced by=RXN-12093}} |
Revision as of 15:38, 10 January 2018
Contents
Metabolite 7-CYANO-7-DEAZAGUANINE
- smiles:
- C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)
- inchi key:
- InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N
- common name:
- preQ0
- molecular weight:
- 175.149
- Synonym(s):
- 7-cyano-7-deazaguanine
- 7-cyano-7-carbaguanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
