Browse wiki
| CPD-14646 |
| Common name | 9-cis-β-carotene + |
|---|---|
| Inchi key | InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N + |
| Molecular weight | 536.882 + |
| Reversible reaction associated | RXN-13641 + |
| Smiles | CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C + |
| Categories | Metabolite |
| Modification date "Modification date" is a predefined property that corresponds to the date of the last modification of a subject and is provided by Semantic MediaWiki.
|
15:33:58, 21 June 2019 + |
| hide properties that link here |
| No properties link to this page. |
