Browse wiki
| CPD1F-133 |
| Common name | Violaxanthin + , 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol + |
|---|---|
| Consumed by | RXN-7984 + |
| Inchi key | InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N + |
| Molecular weight | 600.88 + |
| Produced by | ANXANOR + |
| Reversible reaction associated | RXN-13185 + |
| Smiles | CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4) + |
| Categories | Metabolite |
| Modification date "Modification date" is a predefined property that corresponds to the date of the last modification of a subject and is provided by Semantic MediaWiki.
|
15:30:10, 21 June 2019 + |
| hide properties that link here |
| No properties link to this page. |
