Difference between revisions of "CPD-7417"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...")
 
(Created page with "Category:Gene == Gene Ec-21_004120 == * left end position: ** 5080568 * transcription direction: ** POSITIVE * right end position: ** 5084794 * centisome position: ** 68.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
+
== Gene Ec-21_004120 ==
−
* smiles:
+
* left end position:
−
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
+
** 5080568
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** cis-coumarinic acid-β-D-glucoside
+
** 5084794
−
* molecular weight:
+
* centisome position:
−
** 325.294    
+
** 68.84127    
 
* Synonym(s):
 
* Synonym(s):
−
** coumarinic acid glucoside
+
** Esi_0383_0017
−
** coumarinate glucoside
+
** Esi0383_0017
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8036]]
+
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
** [[pantograph]]-[[aragem]]
 +
* [[RXN-10952]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[RXN-7253]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN0-5408]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
** [[pantograph]]-[[aragem]]
 +
* [[RXNQT-4142]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[PWY-4702]]
 +
* [[PWY-2301]]
 +
* [[PWY-6363]]
 +
* [[PWY-882]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=5080568}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5084794}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223]
+
{{#set: centisome position=68.84127   }}
−
* PUBCHEM:
+
{{#set: common name=Esi_0383_0017|Esi0383_0017}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113]
+
{{#set: reaction associated=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN-10952|RXN-7253|RXN0-5408|RXNQT-4142}}
−
* HMDB : HMDB60077
+
{{#set: pathway associated=PWY-4702|PWY-2301|PWY-6363|PWY-882}}
−
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}}
+
−
{{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}}
+
−
{{#set: common name=cis-coumarinic acid-β-D-glucoside}}
+
−
{{#set: molecular weight=325.294   }}
+
−
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}}
+
−
{{#set: consumed by=RXN-8036}}
+

Revision as of 20:43, 17 March 2018

Gene Ec-21_004120

  • left end position:
    • 5080568
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5084794
  • centisome position:
    • 68.84127
  • Synonym(s):
    • Esi_0383_0017
    • Esi0383_0017

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7417&oldid=10047"