Difference between revisions of "RXN-12871"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2187 CPD-2187] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(COC1(OC(C(C(C1O)O)O)CO))OC(CCCCCCCCC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLBILANE HYDROXYMETHYLBILANE] == * smiles: ** C(O)C1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLBILANE HYDROXYMETHYLBILANE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CC(=O)[O-])C(CCC(=O)[O-])=C(N2)CC4(=C(CC([O-])=O)C(CCC(=O)[O-])=C(CC3(=C(CC([O-])=O)C(CCC(=O)[O-])=CN3))N4))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WDFJYRZCZIUBPR-UHFFFAOYSA-F |
* common name: | * common name: | ||
| − | ** | + | ** preuroporphyrinogen |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 846.757 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** hydroxymethylbilane |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[UROGENIIISYN-RXN]] | ||
| + | * [[RXN-14396]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[OHMETHYLBILANESYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| + | * CAS : 73023-76-4 | ||
| + | * BIGG : 36648 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931104 46931104] |
| − | {{#set: smiles= | + | * HMDB : HMDB01137 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01024 C01024] |
| − | {{#set: molecular weight=757 | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57845 57845] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC57845 |
| + | {{#set: smiles=C(O)C1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CC(=O)[O-])C(CCC(=O)[O-])=C(N2)CC4(=C(CC([O-])=O)C(CCC(=O)[O-])=C(CC3(=C(CC([O-])=O)C(CCC(=O)[O-])=CN3))N4)))}} | ||
| + | {{#set: inchi key=InChIKey=WDFJYRZCZIUBPR-UHFFFAOYSA-F}} | ||
| + | {{#set: common name=preuroporphyrinogen}} | ||
| + | {{#set: molecular weight=846.757 }} | ||
| + | {{#set: common name=hydroxymethylbilane}} | ||
| + | {{#set: consumed by=UROGENIIISYN-RXN|RXN-14396}} | ||
| + | {{#set: produced by=OHMETHYLBILANESYN-RXN}} | ||
Revision as of 20:45, 17 March 2018
Contents
Metabolite HYDROXYMETHYLBILANE
- smiles:
- C(O)C1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CC(=O)[O-])C(CCC(=O)[O-])=C(N2)CC4(=C(CC([O-])=O)C(CCC(=O)[O-])=C(CC3(=C(CC([O-])=O)C(CCC(=O)[O-])=CN3))N4)))
- inchi key:
- InChIKey=WDFJYRZCZIUBPR-UHFFFAOYSA-F
- common name:
- preuroporphyrinogen
- molecular weight:
- 846.757
- Synonym(s):
- hydroxymethylbilane
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73023-76-4
- BIGG : 36648
- PUBCHEM:
- HMDB : HMDB01137
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57845
"C(O)C1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CC(=O)[O-])C(CCC(=O)[O-])=C(N2)CC4(=C(CC([O-])=O)C(CCC(=O)[O-])=C(CC3(=C(CC([O-])=O)C(CCC(=O)[O-])=CN3))N4)))" cannot be used as a page name in this wiki.
