Difference between revisions of "RXN-17019"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
(Created page with "Category:Gene == Gene Ec-21_003610 == * left end position: ** 4593742 * transcription direction: ** POSITIVE * right end position: ** 4598672 * centisome position: ** 62.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_003610 == |
− | * | + | * left end position: |
− | ** | + | ** 4593742 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4598672 |
− | * | + | * centisome position: |
− | ** | + | ** 62.24482 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0072_0092 |
− | ** | + | ** Esi0072_0092 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[GLUTAMINESYN-RXN]] |
− | * [[ | + | ** esiliculosus_genome |
− | * [[ | + | ***ec-number |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | == | + | ** [[pantograph]]-[[aragem]] |
− | + | ** [[pantograph]]-[[aragem]] | |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[GLNSYN-PWY]] |
+ | * [[PWY-5675]] | ||
+ | * [[PWY-381]] | ||
+ | * [[PWY-6549]] | ||
+ | * [[PWY-6964]] | ||
+ | * [[PWY490-3]] | ||
+ | * [[PWY-6963]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4593742}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4598672}} | |
− | + | {{#set: centisome position=62.24482 }} | |
− | + | {{#set: common name=Esi_0072_0092|Esi0072_0092}} | |
− | + | {{#set: reaction associated=GLUTAMINESYN-RXN}} | |
− | + | {{#set: pathway associated=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY490-3|PWY-6963}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:45, 17 March 2018
Gene Ec-21_003610
- left end position:
- 4593742
- transcription direction:
- POSITIVE
- right end position:
- 4598672
- centisome position:
- 62.24482
- Synonym(s):
- Esi_0072_0092
- Esi0072_0092
Reactions associated
- GLUTAMINESYN-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- pantograph-aragem
- pantograph-aragem
- esiliculosus_genome