Difference between revisions of "Ec-13 003550"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-13_003550 == * left end position: ** 5311524 * transcription direction: ** POSITIVE * right end position: ** 5330032 * centisome position: ** 76.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_003550 == |
− | * | + | * left end position: |
− | ** | + | ** 5311524 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5330032 |
− | * | + | * centisome position: |
− | ** | + | ** 76.57612 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0266_0031 | ||
+ | ** Esi0266_0031 | ||
− | == | + | == Reactions associated == |
− | + | * [[3.6.4.4-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5311524}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5330032}} | |
− | {{#set: | + | {{#set: centisome position=76.57612 }} |
− | {{#set: | + | {{#set: common name=Esi_0266_0031|Esi0266_0031}} |
− | {{#set: | + | {{#set: reaction associated=3.6.4.4-RXN}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:45, 17 March 2018
Gene Ec-13_003550
- left end position:
- 5311524
- transcription direction:
- POSITIVE
- right end position:
- 5330032
- centisome position:
- 76.57612
- Synonym(s):
- Esi_0266_0031
- Esi0266_0031
Reactions associated
- 3.6.4.4-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome