Difference between revisions of "PWY-5138"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N |
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** β-D-cellobiose |
| + | * molecular weight: | ||
| + | ** 342.299 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4-O-β-D-glucopyranosyl-β-D-glucopyranose |
| + | ** β-D-glucosyl-(1→4)-β-D-glucose | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10773]] | |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | + | * CAS : 528-50-7 | |
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10712 10712] | |
| − | {{#set: | + | * HMDB : HMDB00055 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06422 C06422] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10261.html 10261] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36217 36217] | ||
| + | {{#set: smiles=C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O}} | ||
| + | {{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N}} | ||
| + | {{#set: common name=β-D-cellobiose}} | ||
| + | {{#set: molecular weight=342.299 }} | ||
| + | {{#set: common name=4-O-β-D-glucopyranosyl-β-D-glucopyranose|β-D-glucosyl-(1→4)-β-D-glucose}} | ||
| + | {{#set: consumed by=RXN-10773}} | ||
Revision as of 20:47, 17 March 2018
Contents
Metabolite CELLOBIOSE
- smiles:
- C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O
- inchi key:
- InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N
- common name:
- β-D-cellobiose
- molecular weight:
- 342.299
- Synonym(s):
- 4-O-β-D-glucopyranosyl-β-D-glucopyranose
- β-D-glucosyl-(1→4)-β-D-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
