Difference between revisions of "Ec-17 003520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.21.6-RXN 1.14.21.6-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Fatty acid hydroxyl...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.21.6-RXN 1.14.21.6-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
 +
* inchi key:
 +
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
 
* common name:
 
* common name:
−
** Fatty acid hydroxylase
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
+
** 266.253   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15680]]
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[CPD-4186]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[CPD-4187]][c] '''+''' 2 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 2 H+[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 lathosterol[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 1 7-dehydrocholesterol[c] '''+''' 2 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_003780]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
−
** '''9''' reactions found over '''22''' reactions in the full pathway
+
−
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
+
−
** '''9''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18924 18924]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18920 18920]
+
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
−
* LIGAND-RXN:
+
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R07215 R07215]
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: molecular weight=266.253    }}
−
{{#set: common name=Fatty acid hydroxylase}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
−
{{#set: ec number=EC-1.14.19.20}}
+
{{#set: consumed by=RXN-15680}}
−
{{#set: gene associated=Ec-01_003780}}
+
−
{{#set: in pathway=PWY66-341|PWY66-3}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 20:48, 17 March 2018

Metabolite CPD-17045

  • smiles:
    • C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
  • inchi key:
    • InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 266.253
  • Synonym(s):
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-17_003520&oldid=10414"