Difference between revisions of "R-3-hydroxylignoceroyl-ACPs"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-05_001880 == * Synonym(s): ** Esi_0184_0004 ** Esi0184_0004 ** CHI-like == Reactions associated == * APIGNAR-RXN ** pantograph-aragem...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-SER HOMO-SER] == * smiles: ** C(CO)C([N+])C([O-])=O * inchi key: ** InChIKey=UKAUYVFTDYCKQ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-SER HOMO-SER] == |
+ | * smiles: | ||
+ | ** C(CO)C([N+])C([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N | ||
+ | * common name: | ||
+ | ** L-homoserine | ||
+ | * molecular weight: | ||
+ | ** 119.12 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** homo-ser |
− | ** | + | ** homoserine |
− | ** | + | ** 2-amino-4-hydroxybutanoic acid |
+ | ** 2-amino-4-hydroxybutanoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[HOMOSERDEAM-RXN]] |
− | + | * [[HOMOSERKIN-RXN]] | |
− | + | * [[HOMSUCTRAN-RXN]] | |
− | + | * [[RXN-14049]] | |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[HOMOSERDEHYDROG-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | * [[CYSTATHIONASE-RXN]] |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 672-15-1 |
− | {{#set: | + | * BIGG : 34437 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971022 6971022] | ||
+ | * HMDB : HMDB00719 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00263 C00263] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57476 57476] | ||
+ | * METABOLIGHTS : MTBLC57476 | ||
+ | {{#set: smiles=C(CO)C([N+])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N}} | ||
+ | {{#set: common name=L-homoserine}} | ||
+ | {{#set: molecular weight=119.12 }} | ||
+ | {{#set: common name=homo-ser|homoserine|2-amino-4-hydroxybutanoic acid|2-amino-4-hydroxybutanoate}} | ||
+ | {{#set: consumed by=HOMOSERDEAM-RXN|HOMOSERKIN-RXN|HOMSUCTRAN-RXN|RXN-14049}} | ||
+ | {{#set: produced by=HOMOSERDEHYDROG-RXN}} | ||
+ | {{#set: reversible reaction associated=CYSTATHIONASE-RXN}} |
Revision as of 21:53, 17 March 2018
Contents
Metabolite HOMO-SER
- smiles:
- C(CO)C([N+])C([O-])=O
- inchi key:
- InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N
- common name:
- L-homoserine
- molecular weight:
- 119.12
- Synonym(s):
- homo-ser
- homoserine
- 2-amino-4-hydroxybutanoic acid
- 2-amino-4-hydroxybutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 672-15-1
- BIGG : 34437
- PUBCHEM:
- HMDB : HMDB00719
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57476
"C(CO)C([N+])C([O-])=O" cannot be used as a page name in this wiki.