Difference between revisions of "HCO3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JCZF...")
 
(Created page with "Category:Gene == Gene Ec-11_002480 == * left end position: ** 2611521 * transcription direction: ** NEGATIVE * right end position: ** 2624115 * centisome position: ** 41.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] ==
+
== Gene Ec-11_002480 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
+
** 2611521
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 2-epi-5-epi-valiolone
+
** 2624115
−
* molecular weight:
+
* centisome position:
−
** 192.168    
+
** 41.520874    
 
* Synonym(s):
 
* Synonym(s):
−
** (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one
+
** Esi_0048_0004
 +
** Esi0048_0004
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
−
* [[RXN-9140]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 +
* [[PWY66-423]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2611521}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201976 25201976]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2624115}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84187 84187]
+
{{#set: centisome position=41.520874   }}
−
{{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}}
+
{{#set: common name=Esi_0048_0004|Esi0048_0004}}
−
{{#set: inchi key=InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N}}
+
{{#set: reaction associated=6-PHOSPHOFRUCTO-2-KINASE-RXN}}
−
{{#set: common name=2-epi-5-epi-valiolone}}
+
{{#set: pathway associated=PWY66-423}}
−
{{#set: molecular weight=192.168   }}
+
−
{{#set: common name=(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}}
+
−
{{#set: produced by=RXN-9140}}
+

Revision as of 20:56, 17 March 2018

Gene Ec-11_002480

  • left end position:
    • 2611521
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2624115
  • centisome position:
    • 41.520874
  • Synonym(s):
    • Esi_0048_0004
    • Esi0048_0004

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=HCO3&oldid=10932"