Difference between revisions of "UMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...") |
(Created page with "Category:Gene == Gene Ec-09_004680 == * left end position: ** 5307215 * transcription direction: ** NEGATIVE * right end position: ** 5311116 * centisome position: ** 94.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_004680 == |
− | * | + | * left end position: |
− | ** | + | ** 5307215 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5311116 |
− | * | + | * centisome position: |
− | ** | + | ** 94.54949 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0049_0025 |
− | ** | + | ** Esi0049_0025 |
− | ** | + | ** GPX |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[GLUTATHIONE-PEROXIDASE-RXN]] |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***ec-number |
− | + | == Pathways associated == | |
+ | * [[DETOX1-PWY-1]] | ||
+ | * [[PWY-4081]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5307215}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5311116}} | |
− | + | {{#set: centisome position=94.54949 }} | |
− | + | {{#set: common name=Esi_0049_0025|Esi0049_0025|GPX}} | |
− | + | {{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}} | |
− | + | {{#set: pathway associated=DETOX1-PWY-1|PWY-4081}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:56, 17 March 2018
Gene Ec-09_004680
- left end position:
- 5307215
- transcription direction:
- NEGATIVE
- right end position:
- 5311116
- centisome position:
- 94.54949
- Synonym(s):
- Esi_0049_0025
- Esi0049_0025
- GPX
Reactions associated
- GLUTATHIONE-PEROXIDASE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome