Difference between revisions of "Ec-26 004980"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
 
(Created page with "Category:Gene == Gene Ec-21_001850 == * left end position: ** 2928730 * transcription direction: ** POSITIVE * right end position: ** 2931739 * centisome position: ** 39.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Gene Ec-21_001850 ==
−
* smiles:
+
* left end position:
−
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** 2928730
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 15,16-dihydrobiliverdin
+
** 2931739
−
* molecular weight:
+
* centisome position:
−
** 582.655    
+
** 39.684048    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0147_0062
 +
** Esi0147_0062
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.3.7.3-RXN]]
+
* [[1.1.1.145-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
* [[1.1.1.170-RXN]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-12693]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-12747]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-12789]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-13926]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN66-18]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN66-23]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN66-313]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN66-318]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY66-341]]
 +
* [[PWY-6074]]
 +
* [[PWY66-3]]
 +
* [[PWY-6946]]
 +
* [[PWY-6944]]
 +
* [[PWY66-4]]
 +
* [[PWY-6948]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2928730}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2931739}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
+
{{#set: centisome position=39.684048    }}
−
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: common name=Esi_0147_0062|Esi0147_0062}}
−
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
+
{{#set: reaction associated=1.1.1.145-RXN|1.1.1.170-RXN|RXN-12693|RXN-12747|RXN-12789|RXN-13926|RXN66-18|RXN66-23|RXN66-313|RXN66-318}}
−
{{#set: common name=15,16-dihydrobiliverdin}}
+
{{#set: pathway associated=PWY66-341|PWY-6074|PWY66-3|PWY-6946|PWY-6944|PWY66-4|PWY-6948}}
−
{{#set: molecular weight=582.655    }}
+
−
{{#set: consumed by=1.3.7.3-RXN}}
+

Revision as of 20:59, 17 March 2018

Gene Ec-21_001850

  • left end position:
    • 2928730
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2931739
  • centisome position:
    • 39.684048
  • Synonym(s):
    • Esi_0147_0062
    • Esi0147_0062

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_004980&oldid=11141"