Difference between revisions of "PWY-5663"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16425 RXN-16425] == * direction: ** REVERSIBLE * common name: ** Phosphoacetylglucosamine mutas...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16425 RXN-16425] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Phosphoacetylglucosamine mutase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[N-ACETYL-D-GLUCOSAMINE-6-P]][c] '''+''' 1 [[Phosphoacetylglucosamine-Mutase-P]][c] '''<=>''' 1 [[Phosphoacetylglucosamine-Mutase]][c] '''+''' 1 [[N-ACETYL-D-GLUCOSAMINE-16-BIS-P]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 N-acetyl-D-glucosamine 6-phosphate[c] '''+''' 1 a phosphorylated phosphoacetylglucosamine mutase[c] '''<=>''' 1 a phosphoacetylglucosamine mutase[c] '''+''' 1 N-acetyl-D-glucosamine 1,6-bisphosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Ec-10_005030]] | ||
| + | ** ESILICULOSUS_GENOME | ||
| + | ***EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Phosphoacetylglucosamine mutase}} | |
| − | + | {{#set: gene associated=Ec-10_005030}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 21:00, 17 March 2018
Contents
Reaction RXN-16425
- direction:
- REVERSIBLE
- common name:
- Phosphoacetylglucosamine mutase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 N-ACETYL-D-GLUCOSAMINE-6-P[c] + 1 Phosphoacetylglucosamine-Mutase-P[c] <=> 1 Phosphoacetylglucosamine-Mutase[c] + 1 N-ACETYL-D-GLUCOSAMINE-16-BIS-P[c]
- With common name(s):
- 1 N-acetyl-D-glucosamine 6-phosphate[c] + 1 a phosphorylated phosphoacetylglucosamine mutase[c] <=> 1 a phosphoacetylglucosamine mutase[c] + 1 N-acetyl-D-glucosamine 1,6-bisphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-10_005030
- ESILICULOSUS_GENOME
- EC-NUMBER
- ESILICULOSUS_GENOME
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
