Difference between revisions of "GLUTAMINEFUM-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-462 RXN1F-462] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-462 RXN1F-462] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.91 EC-2.4.1.91]
+
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
 +
* common name:
 +
** cycloartenol
 +
* molecular weight:
 +
** 426.724   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9β,19-cyclo-24-lanosten-3β-ol
 +
** cycloart-24(25)-enol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-4021]]
−
** 1 [[CPD-520]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD1F-437]][c] '''+''' 1 [[UDP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[CYCLOARTENOL-SYNTHASE-RXN]]
−
** 1 quercetin[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 H+[c] '''+''' 1 quercetin-3-glucoside[c] '''+''' 1 UDP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-04_004610]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-14_000870]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7172]]: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7172 PWY-7172]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7173]], quercetin triglucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7173 PWY-7173]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5390]], rutin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5390 PWY-5390]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5321]], quercetin glycoside biosynthesis (Arabidopsis): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5321 PWY-5321]
+
−
** '''1''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWY-7129]], quercetin glucoside biosynthesis (Allium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7129 PWY-7129]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7137]], quercetin gentiotetraside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7137 PWY-7137]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CAS : 469-38-5
−
** [http://www.genome.jp/dbget-bin/www_bget?R02158 R02158]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657627 90657627]
−
{{#set: ec number=EC-2.4.1.91}}
+
* CHEBI:
−
{{#set: gene associated=Ec-04_004610|Ec-14_000870}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
−
{{#set: in pathway=PWY-7172|PWY-7173|PWY-5390|PWY-5321|PWY-7129|PWY-7137}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
−
{{#set: reconstruction tool=pantograph}}
+
* HMDB : HMDB36591
−
{{#set: reconstruction source=aragem}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
 +
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
 +
{{#set: common name=cycloartenol}}
 +
{{#set: molecular weight=426.724    }}
 +
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
 +
{{#set: consumed by=RXN-4021}}
 +
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}

Revision as of 22:01, 17 March 2018

Metabolite CYCLOARTENOL

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
  • inchi key:
    • InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
  • common name:
    • cycloartenol
  • molecular weight:
    • 426.724
  • Synonym(s):
    • 9β,19-cyclo-24-lanosten-3β-ol
    • cycloart-24(25)-enol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLUTAMINEFUM-PWY&oldid=11281"