Difference between revisions of "PWY-5989"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14882 RXN-14882] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) |
+ | * inchi key: | ||
+ | ** InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N | ||
+ | * common name: | ||
+ | ** dihydrozeatin | ||
+ | * molecular weight: | ||
+ | ** 221.261 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol | ||
+ | ** N6-(4-Hydroxyisopentanyl)adenine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-4726]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 23599-75-9 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439631 439631] |
− | {{#set: | + | * HMDB : HMDB12215 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02029 C02029] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.388705.html 388705] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17874 17874] | ||
+ | {{#set: smiles=CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))}} | ||
+ | {{#set: inchi key=InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N}} | ||
+ | {{#set: common name=dihydrozeatin}} | ||
+ | {{#set: molecular weight=221.261 }} | ||
+ | {{#set: common name=2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol|N6-(4-Hydroxyisopentanyl)adenine}} | ||
+ | {{#set: consumed by=RXN-4726}} |
Revision as of 21:01, 17 March 2018
Contents
Metabolite CPD-332
- smiles:
- CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))
- inchi key:
- InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N
- common name:
- dihydrozeatin
- molecular weight:
- 221.261
- Synonym(s):
- 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol
- N6-(4-Hydroxyisopentanyl)adenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 23599-75-9
- PUBCHEM:
- HMDB : HMDB12215
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI: