Difference between revisions of "GLYCOLATE-REDUCTASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJR...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2KETO-3METHYLVALERATE-RXN 2KETO-3METHYLVALERATE-RXN] == * direction: ** REVERSIBLE * common name: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2KETO-3METHYLVALERATE-RXN 2KETO-3METHYLVALERATE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** (S)-3-methyl-2-oxopentanoate dehydrogenase (acylating) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1 EC-1.2.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[CO-A]][c] '''+''' 1 [[2-KETO-3-METHYL-VALERATE]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[2-METHYL-BUTYRYL-COA]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 coenzyme A[c] '''+''' 1 (S)-3-methyl-2-oxopentanoate[c] '''+''' 1 NAD+[c] '''<=>''' 1 NADH[c] '''+''' 1 CO2[c] '''+''' 1 2-methylbutanoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-5108]], L-isoleucine biosynthesis V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5108 PWY-5108] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[ILEUDEG-PWY]], L-isoleucine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=ILEUDEG-PWY ILEUDEG-PWY] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30907 30907] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03171 R03171] | |
− | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=(S)-3-methyl-2-oxopentanoate dehydrogenase (acylating)}} |
− | + | {{#set: ec number=EC-1.2.1}} | |
− | + | {{#set: in pathway=PWY-5108|ILEUDEG-PWY}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:03, 17 March 2018
Contents
Reaction 2KETO-3METHYLVALERATE-RXN
- direction:
- REVERSIBLE
- common name:
- (S)-3-methyl-2-oxopentanoate dehydrogenase (acylating)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CO-A[c] + 1 2-KETO-3-METHYL-VALERATE[c] + 1 NAD[c] <=> 1 NADH[c] + 1 CARBON-DIOXIDE[c] + 1 2-METHYL-BUTYRYL-COA[c]
- With common name(s):
- 1 coenzyme A[c] + 1 (S)-3-methyl-2-oxopentanoate[c] + 1 NAD+[c] <=> 1 NADH[c] + 1 CO2[c] + 1 2-methylbutanoyl-CoA[c]
Genes associated with this reaction
Pathways
- PWY-5108, L-isoleucine biosynthesis V: PWY-5108
- 2 reactions found over 3 reactions in the full pathway
- ILEUDEG-PWY, L-isoleucine degradation I: ILEUDEG-PWY
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links