Difference between revisions of "Ec-23 001510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PNKIN-RXN PNKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Pyridoxamine kinase * ec nu...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PNKIN-RXN PNKIN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Pyridoxamine kinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.35 EC-2.7.1.35] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[PYRIDOXINE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PYRIDOXINE-5P]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 pyridoxine[c] '''=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 pyridoxine 5'-phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-02_001230]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***EC-NUMBER | ||
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204] | ||
+ | ** '''5''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7282]], 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282] | ||
+ | ** '''5''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25108 25108] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01909 R01909] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=Pyridoxamine kinase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.7.1.35}} |
− | {{#set: | + | {{#set: gene associated=Ec-02_001230}} |
− | {{#set: | + | {{#set: in pathway=PWY-7204|PWY-7282|PLPSAL-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + |
Revision as of 21:04, 17 March 2018
Contents
Reaction PNKIN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Pyridoxamine kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 PYRIDOXINE[c] => 1 ADP[c] + 1 PROTON[c] + 1 PYRIDOXINE-5P[c]
- With common name(s):
- 1 ATP[c] + 1 pyridoxine[c] => 1 ADP[c] + 1 H+[c] + 1 pyridoxine 5'-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-02_001230
- ESILICULOSUS_GENOME
- EC-NUMBER
- pantograph-aragem
- ESILICULOSUS_GENOME
Pathways
- PWY-7204, pyridoxal 5'-phosphate salvage II (plants): PWY-7204
- 5 reactions found over 9 reactions in the full pathway
- PWY-7282, 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): PWY-7282
- 5 reactions found over 9 reactions in the full pathway
- PLPSAL-PWY, pyridoxal 5'-phosphate salvage I: PLPSAL-PWY
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links