Difference between revisions of "PWY-7767"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == * smiles: ** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))...")
 
(Created page with "Category:Gene == Gene Ec-01_000230 == * left end position: ** 147143 * transcription direction: ** POSITIVE * right end position: ** 158447 * centisome position: ** 1.4259...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] ==
+
== Gene Ec-01_000230 ==
−
* smiles:
+
* left end position:
−
** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
+
** 147143
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O
+
** POSITIVE
−
* common name:
+
* right end position:
−
** deacetylmycothiol
+
** 158447
−
* molecular weight:
+
* centisome position:
−
** 445.461    
+
** 1.4259654    
 
* Synonym(s):
 
* Synonym(s):
−
** 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside
+
** Esi_0207_0034
−
** Cys-GlcN-Ins
+
** Esi0207_0034
−
** 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
+
−
** desacetylmycothiol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN0-1281]]
−
* [[RXN1G-121]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=147143}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878469 46878469]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=158447}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58887 58887]
+
{{#set: centisome position=1.4259654   }}
−
{{#set: smiles=C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)}}
+
{{#set: common name=Esi_0207_0034|Esi0207_0034}}
−
{{#set: inchi key=InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O}}
+
{{#set: reaction associated=RXN0-1281}}
−
{{#set: common name=deacetylmycothiol}}
+
−
{{#set: molecular weight=445.461   }}
+
−
{{#set: common name=1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside|Cys-GlcN-Ins|3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol|desacetylmycothiol}}
+
−
{{#set: produced by=RXN1G-121}}
+

Revision as of 21:05, 17 March 2018

Gene Ec-01_000230

  • left end position:
    • 147143
  • transcription direction:
    • POSITIVE
  • right end position:
    • 158447
  • centisome position:
    • 1.4259654
  • Synonym(s):
    • Esi_0207_0034
    • Esi0207_0034

Reactions associated

  • RXN0-1281
    • esiliculosus_genome
      • automated-name-match

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7767&oldid=11576"