Difference between revisions of "CPD-15436"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...")
 
(Created page with "Category:Gene == Gene Ec-15_001630 == * left end position: ** 1882664 * transcription direction: ** NEGATIVE * right end position: ** 1896462 * centisome position: ** 34.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+
== Gene Ec-15_001630 ==
−
* smiles:
+
* left end position:
−
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
+
** 1882664
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** N-acetyl-serotonin sulfate
+
** 1896462
−
* molecular weight:
+
* centisome position:
−
** 297.305    
+
** 34.87543    
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetyl-5-hydroxytryptamine sulfate
+
** Esi_0056_0059
 +
** Esi0056_0059
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
−
* [[RXN-11059]]
+
** [[pantograph]]-[[aragem]]
−
== Reaction(s) of unknown directionality ==
+
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[RXN-11135]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7539]]
 +
* [[PWY-6797]]
 +
* [[PWY-6147]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1882664}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479248 45479248]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB60834
+
{{#set: right end position=1896462}}
−
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
+
{{#set: centisome position=34.87543   }}
−
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
+
{{#set: common name=Esi_0056_0059|Esi0056_0059}}
−
{{#set: common name=N-acetyl-serotonin sulfate}}
+
{{#set: reaction associated=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN|H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN|RXN-11135}}
−
{{#set: molecular weight=297.305   }}
+
{{#set: pathway associated=PWY-7539|PWY-6797|PWY-6147}}
−
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
+
−
{{#set: produced by=RXN-11059}}
+

Revision as of 21:08, 17 March 2018

Gene Ec-15_001630

  • left end position:
    • 1882664
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1896462
  • centisome position:
    • 34.87543
  • Synonym(s):
    • Esi_0056_0059
    • Esi0056_0059

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-15436&oldid=11799"