Difference between revisions of "Ec-16 000550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PROSYN-PWY PROSYN-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
 
* common name:
 
* common name:
−
** L-proline biosynthesis I
+
** leucodopachrome
 +
* molecular weight:
 +
** 194.166   
 
* Synonym(s):
 
* Synonym(s):
 +
** cyclo-dopa
 +
** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''4''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-11369]]
−
* [[GLUTKIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
* [[GLUTSEMIALDEHYDROG-RXN]]
+
* [[RXN-8483]]
−
* [[PYRROLINECARBREDUCT-RXN]]
+
== Reaction(s) of unknown directionality ==
−
* [[SPONTPRO-RXN]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PROSYN-PWY PROSYN-PWY]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233]
−
{{#set: taxonomic range=TAX-4751}}
+
* LIGAND-CPD:
−
{{#set: taxonomic range=TAX-33154}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604]
−
{{#set: taxonomic range=TAX-2}}
+
* HMDB : HMDB04067
−
{{#set: common name=L-proline biosynthesis I}}
+
{{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}}
−
{{#set: reaction found=4}}
+
{{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}}
−
{{#set: reaction not found=4}}
+
{{#set: common name=leucodopachrome}}
−
{{#set: completion rate=100.0}}
+
{{#set: molecular weight=194.166    }}
 +
{{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}}
 +
{{#set: consumed by=RXN-11369}}
 +
{{#set: produced by=RXN-8483}}

Revision as of 21:09, 17 March 2018

Metabolite CPD-8652

  • smiles:
    • C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
  • inchi key:
    • InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
  • common name:
    • leucodopachrome
  • molecular weight:
    • 194.166
  • Synonym(s):
    • cyclo-dopa
    • 2-carboxy-2,3-dihydro-5,6-dihydroxyindole

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_000550&oldid=11834"