Difference between revisions of "Ec-20 003500"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18390 CPD-18390] == * smiles: ** CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCCCCCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18390 CPD-18390] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCCCCCCC)=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GLOXZZHEZYKXNV-WJOKGBTCSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 1-palmitoyl-2-myristoyl phosphatidate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 618.83 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17023]] |
| + | * [[RXN-17024]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCCCCCCC)=O}} | |
| − | + | {{#set: inchi key=InChIKey=GLOXZZHEZYKXNV-WJOKGBTCSA-L}} | |
| − | + | {{#set: common name=1-palmitoyl-2-myristoyl phosphatidate}} | |
| − | + | {{#set: molecular weight=618.83 }} | |
| − | + | {{#set: produced by=RXN-17023|RXN-17024}} | |
| − | {{#set: smiles= | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 21:09, 17 March 2018
Contents
Metabolite CPD-18390
- smiles:
- CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCCCCCCC)=O
- inchi key:
- InChIKey=GLOXZZHEZYKXNV-WJOKGBTCSA-L
- common name:
- 1-palmitoyl-2-myristoyl phosphatidate
- molecular weight:
- 618.83
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCCCCCCC)=O" cannot be used as a page name in this wiki.
