Difference between revisions of "CDP-ETHANOLAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-218 TRANS-RXN-218] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula ==...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-218 TRANS-RXN-218] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 2 [[PROTON]][c] '''=>''' 2 [[PROTON]][e] |
− | * [[ | + | * With common name(s): |
− | + | ** 2 H+[c] '''=>''' 2 H+[e] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | * | + | == Pathways == |
− | * [ | + | == Reconstruction information == |
− | + | * Category: [[annotation]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Tool: [[pathwaytools]] |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 21:10, 17 March 2018
Contents
Reaction TRANS-RXN-218
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome