Difference between revisions of "Ec-28 001790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_SULFATE ExchangeSeed_SULFATE] == * direction: ** REVERSIBLE * Synonym(s): == Reaction...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_SULFATE ExchangeSeed_SULFATE] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
+
−
* common name:
+
−
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
+
−
* molecular weight:
+
−
** 959.791   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-12:1-Δ5-CoA
 
−
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17798]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[SULFATE]][C-BOUNDARY] '''<=>''' 1.0 [[SULFATE]][e]
−
* [[RXN-17797]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 sulfate[C-BOUNDARY] '''<=>''' 1.0 sulfate[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
+
{{#set: in pathway=}}
−
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
+
{{#set: reconstruction category=manual}}
−
{{#set: molecular weight=959.791    }}
+
{{#set: reconstruction source=manual-import_from_medium}}
−
{{#set: common name=(S)-3-hydroxy-12:1-&Delta;5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
+
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
−
{{#set: consumed by=RXN-17798}}
+
−
{{#set: produced by=RXN-17797}}
+

Revision as of 21:11, 17 March 2018

Reaction ExchangeSeed_SULFATE

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 sulfate[C-BOUNDARY] <=> 1.0 sulfate[e]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-28_001790&oldid=11961"