Difference between revisions of "Protein-Ox-Disulfides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
 
(Created page with "Category:Gene == Gene Ec-28_000420 == * left end position: ** 439635 * transcription direction: ** POSITIVE * right end position: ** 452607 * centisome position: ** 11.602...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Gene Ec-28_000420 ==
−
* smiles:
+
* left end position:
−
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
+
** 439635
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
** 452607
−
* molecular weight:
+
* centisome position:
−
** 185.136    
+
** 11.602868    
 
* Synonym(s):
 
* Synonym(s):
−
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
+
** Esi_0120_0074
 +
** Esi0120_0074
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14014]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[DIHYDRODIPICSYN-RXN]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-12195]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-12196]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN0-5462]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=439635}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=452607}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
+
{{#set: centisome position=11.602868   }}
−
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
+
{{#set: common name=Esi_0120_0074|Esi0120_0074}}
−
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: molecular weight=185.136   }}
+
−
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
+
−
{{#set: consumed by=RXN-14014}}
+
−
{{#set: produced by=DIHYDRODIPICSYN-RXN}}
+

Revision as of 22:14, 17 March 2018

Gene Ec-28_000420

  • left end position:
    • 439635
  • transcription direction:
    • POSITIVE
  • right end position:
    • 452607
  • centisome position:
    • 11.602868
  • Synonym(s):
    • Esi_0120_0074
    • Esi0120_0074

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Protein-Ox-Disulfides&oldid=12228"