Difference between revisions of "O-phospho-tau-proteins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=REDUCED-MENAQUINONE REDUCED-MENAQUINONE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=REDUCED-MENAQUINONE REDUCED-MENAQUINONE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2)) |
− | ** | + | * inchi key: |
+ | ** InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** menaquinol-8 |
+ | * molecular weight: | ||
+ | ** 719.144 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** reduced menaquinone-8 |
+ | ** MKH2-8 | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479636 45479636] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61684 61684] |
− | {{#set: | + | * BIGG : 46564 |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N}} |
+ | {{#set: common name=menaquinol-8}} | ||
+ | {{#set: molecular weight=719.144 }} | ||
+ | {{#set: common name=reduced menaquinone-8|MKH2-8}} | ||
+ | {{#set: produced by=ADOMET-DMK-METHYLTRANSFER-RXN}} |
Revision as of 21:14, 17 March 2018
Contents
Metabolite REDUCED-MENAQUINONE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2))
- inchi key:
- InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N
- common name:
- menaquinol-8
- molecular weight:
- 719.144
- Synonym(s):
- reduced menaquinone-8
- MKH2-8
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links