Difference between revisions of "PHOSNACMURPENTATRANS-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_004380 == * left end position: ** 3771201 * transcription direction: ** POSITIVE * right end position: ** 3795011 * centisome position: ** 36.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == |
− | * | + | * smiles: |
− | ** | + | ** C2(C=CC1(=C(C(O)=CN1)C=2)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N |
− | * | + | * common name: |
− | ** | + | ** indoxyl |
− | * | + | * molecular weight: |
− | ** | + | ** 133.149 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** indole-3-ol |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-15587]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50591 50591] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.45861.html 45861] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17840 17840] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05658 C05658] | ||
+ | * HMDB : HMDB04094 | ||
+ | {{#set: smiles=C2(C=CC1(=C(C(O)=CN1)C=2))}} | ||
+ | {{#set: inchi key=InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=indoxyl}} | ||
+ | {{#set: molecular weight=133.149 }} | ||
+ | {{#set: common name=indole-3-ol}} | ||
+ | {{#set: reversible reaction associated=RXN-15587}} |
Revision as of 22:19, 17 March 2018
Contents
Metabolite INDOXYL
- smiles:
- C2(C=CC1(=C(C(O)=CN1)C=2))
- inchi key:
- InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
- common name:
- indoxyl
- molecular weight:
- 133.149
- Synonym(s):
- indole-3-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links