Difference between revisions of "PWY-6531"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579] ==
* smiles:
+
* taxonomic range:
** COC1(C(O)C(O)C(O)C(O)C(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
* inchi key:
+
** InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N
+
 
* common name:
 
* common name:
** D-ononitol
+
** phycourobilin biosynthesis
* molecular weight:
+
** 194.184   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-O-methyl-myo-inositol
 
** ononitol
 
** 1D-4-O-methyl-myo-inositol
 
** 4-methyl-myo-inositol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-8281]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.3.7.3-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-22_000060]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.2-RXN 1.3.7.2-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15985 RXN-15985]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15990 RXN-15990]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17523 RXN-17523]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-1117}}
** [http://www.genome.jp/dbget-bin/www_bget?C06352 C06352]
+
{{#set: common name=phycourobilin biosynthesis}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18266 18266]
+
{{#set: total reaction=5}}
* PUBCHEM:
+
{{#set: completion rate=20.0}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12300199 12300199]
+
* HMDB : HMDB29915
+
{{#set: smiles=COC1(C(O)C(O)C(O)C(O)C(O)1)}}
+
{{#set: inchi key=InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N}}
+
{{#set: common name=D-ononitol}}
+
{{#set: molecular weight=194.184    }}
+
{{#set: common name=4-O-methyl-myo-inositol|ononitol|1D-4-O-methyl-myo-inositol|4-methyl-myo-inositol}}
+
{{#set: consumed by=RXN-8281}}
+

Revision as of 21:19, 17 March 2018

Pathway PWY-7579

  • taxonomic range:
  • common name:
    • phycourobilin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links