Difference between revisions of "Ec-11 005650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: **...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] == * common name: ** a reduc...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] ==
−
* smiles:
+
−
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
+
−
* inchi key:
+
−
** InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L
+
 
* common name:
 
* common name:
−
** dUMP
+
** a reduced [NADPH-hemoprotein reductase]
−
* molecular weight:
+
−
** 306.168   
+
 
* Synonym(s):
 
* Synonym(s):
−
** U
 
−
** deoxyurdine-phosphate
 
−
** 2'-deoxyuridine 5-monophosphate
 
−
** deoxyuridine-phosphate
 
−
** 2'-deoxyuridine 5'-phosphate
 
−
** 2'-deoxyuridylic acid
 
−
** 2'-deoxy-5'-uridylic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[THYMIDYLATESYN-RXN]]
+
* [[RXN66-181]]
 +
* [[RXN66-161]]
 +
* [[RXN-8630]]
 +
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 +
* [[RXN-11057]]
 +
* [[RXN-11056]]
 +
* [[RXN66-169]]
 +
* [[RXN66-146]]
 +
* [[RXN66-163]]
 +
* [[SQUALENE-MONOOXYGENASE-RXN]]
 +
* [[RXN-17627]]
 +
* [[RXN-13064]]
 +
* [[RXN-8872]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DUTP-PYROP-RXN]]
 
−
* [[RXN-14199]]
 
−
* [[DCMP-DEAMINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-14220]]
+
* [[RXN-17625]]
 
== External links  ==
 
== External links  ==
−
* CAS : 964-26-1
+
{{#set: common name=a reduced [NADPH-hemoprotein reductase]}}
−
* BIGG : 34762
+
{{#set: consumed by=RXN66-181|RXN66-161|RXN-8630|UNSPECIFIC-MONOOXYGENASE-RXN|RXN-11057|RXN-11056|RXN66-169|RXN66-146|RXN66-163|SQUALENE-MONOOXYGENASE-RXN|RXN-17627|RXN-13064|RXN-8872}}
−
* PUBCHEM:
+
{{#set: reversible reaction associated=RXN-17625}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=18601100 18601100]
+
−
* HMDB : HMDB01409
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00365 C00365]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.18555972.html 18555972]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=246422 246422]
+
−
* METABOLIGHTS : MTBLC246422
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L}}
+
−
{{#set: common name=dUMP}}
+
−
{{#set: molecular weight=306.168    }}
+
−
{{#set: common name=U|deoxyurdine-phosphate|2'-deoxyuridine 5-monophosphate|deoxyuridine-phosphate|2'-deoxyuridine 5'-phosphate|2'-deoxyuridylic acid|2'-deoxy-5'-uridylic acid}}
+
−
{{#set: consumed by=THYMIDYLATESYN-RXN}}
+
−
{{#set: produced by=DUTP-PYROP-RXN|RXN-14199|DCMP-DEAMINASE-RXN}}
+
−
{{#set: consumed or produced by=RXN-14220}}
+

Revision as of 22:19, 17 March 2018

Metabolite Red-NADPH-Hemoprotein-Reductases

  • common name:
    • a reduced [NADPH-hemoprotein reductase]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a reduced [NADPH-hemoprotein reductase" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-11_005650&oldid=12538"