Difference between revisions of "IMP-DEHYDROG-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LACTOSEUTIL-PWY LACTOSEUTIL-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LACTOSEUTIL-PWY LACTOSEUTIL-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** lactose degradation II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** lactose degradation 2 |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | * [[ | + | * [[KETOLACTOSE-RXN]] |
| − | + | ** 2 associated gene(s): | |
| − | == Reaction(s) | + | *** [[Ec-06_001410]] |
| − | * [ | + | *** [[Ec-12_007000]] |
| − | + | ** 1 reconstruction source(s) associated: | |
| − | * [ | + | *** [[annotation-esiliculosus_genome]] |
| − | + | == Reaction(s) not found == | |
| + | * [http://metacyc.org/META/NEW-IMAGE?object=KETOGAL-DEHYDROXY-RXN KETOGAL-DEHYDROXY-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=LACTOSE-DEHYDRO-RXN LACTOSE-DEHYDRO-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1224}} | |
| − | + | {{#set: common name=lactose degradation II}} | |
| − | + | {{#set: common name=lactose degradation 2}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name=2 | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 21:20, 17 March 2018
Pathway LACTOSEUTIL-PWY
- taxonomic range:
- common name:
- lactose degradation II
- Synonym(s):
- lactose degradation 2
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- KETOLACTOSE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
