Difference between revisions of "Ec-12 005020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-17_002680 == * left end position: ** 2865242 * transcription direction: ** POSITIVE * right end position: ** 2867734 * centisome position: ** 59.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2) *...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-17_002680 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] ==
−
* left end position:
+
* smiles:
−
** 2865242
+
** C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
−
* right end position:
+
* common name:
−
** 2867734
+
** 5-amino-6-(5-phospho-D-ribosylamino)uracil
−
* centisome position:
+
* molecular weight:
−
** 59.718086    
+
** 352.197    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0026_0123
+
** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
−
** Esi0026_0123
+
** 5-amino-6-(5'-phosphoribosylamino)uracil
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN0-2381]]
+
* [[RIBOFLAVINSYNREDUC-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RIBOFLAVINSYNDEAM-RXN]]
−
* [[RXN0-2382]]
+
== Reaction(s) of unknown directionality ==
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
* [[TRYPSYN-RXN]]
+
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[TRPSYN-PWY]]
+
−
* [[PWY-6949]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2865242}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245199 25245199]
−
{{#set: right end position=2867734}}
+
* CHEBI:
−
{{#set: centisome position=59.718086   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453]
−
{{#set: common name=Esi_0026_0123|Esi0026_0123}}
+
* BIGG : 37234
−
{{#set: reaction associated=RXN0-2381|RXN0-2382|TRYPSYN-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=TRPSYN-PWY|PWY-6949}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268]
 +
{{#set: smiles=C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)}}
 +
{{#set: inchi key=InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L}}
 +
{{#set: common name=5-amino-6-(5-phospho-D-ribosylamino)uracil}}
 +
{{#set: molecular weight=352.197   }}
 +
{{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}}
 +
{{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}}
 +
{{#set: produced by=RIBOFLAVINSYNDEAM-RXN}}

Revision as of 21:22, 17 March 2018

Metabolite CPD-602

  • smiles:
    • C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)
  • inchi key:
    • InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
  • common name:
    • 5-amino-6-(5-phospho-D-ribosylamino)uracil
  • molecular weight:
    • 352.197
  • Synonym(s):
    • 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
    • 5-amino-6-(5'-phosphoribosylamino)uracil

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_005020&oldid=12737"