Difference between revisions of "PWY-6416"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-12 RXN66-12] == * direction: ** LEFT-TO-RIGHT * common name: ** 4,4-dimethyl-14α-hydrox...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-12 RXN66-12] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
 +
* inchi key:
 +
** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol 14-dehydrogenase
+
** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
−
** Cytochrome P450
+
* molecular weight:
 +
** 334.43   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13677]]
−
** 1 [[CPD-8607]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[CPD-8608]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 2 H2O[c] '''+''' 1 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-10_006240]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
+
−
** '''9''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol 14-dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346]
−
{{#set: common name=Cytochrome P450}}
+
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}}
−
{{#set: gene associated=Ec-10_006240}}
+
{{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}}
−
{{#set: in pathway=PWY66-3}}
+
{{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=334.43    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-13677}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 21:22, 17 March 2018

Metabolite CPD-14705

  • smiles:
    • CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
  • inchi key:
    • InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
  • common name:
    • 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
  • molecular weight:
    • 334.43
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.
"4-hydroxy-2-nonenal-[Cys-Gly] conjugate" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6416&oldid=12745"