Difference between revisions of "PWY-6012-1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) |
+ | * inchi key: | ||
+ | ** InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** dihydrozeatin-O-glucoside |
+ | * molecular weight: | ||
+ | ** 383.403 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-4726]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658286 90658286] |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448] |
− | {{#set: | + | * HMDB : HMDB12214 |
− | {{#set: | + | {{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N}} |
− | {{#set: | + | {{#set: common name=dihydrozeatin-O-glucoside}} |
+ | {{#set: molecular weight=383.403 }} | ||
+ | {{#set: produced by=RXN-4726}} |
Revision as of 22:22, 17 March 2018
Contents
Metabolite CPD-4617
- smiles:
- CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
- inchi key:
- InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
- common name:
- dihydrozeatin-O-glucoside
- molecular weight:
- 383.403
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links