Difference between revisions of "5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C(O...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2) |
+ | * inchi key: | ||
+ | ** InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** nigerose |
+ | * molecular weight: | ||
+ | ** 342.299 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** α-1,3-glucose disaccharide | ||
+ | ** sakebiose | ||
+ | ** 3-O-α-D-glucopyranosyl-D-glucopyranose | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN0-5395]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439512 439512] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7570 7570] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01518 C01518] | ||
+ | * HMDB : HMDB29882 | ||
+ | {{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)}} | ||
+ | {{#set: inchi key=InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N}} | ||
+ | {{#set: common name=nigerose}} | ||
+ | {{#set: molecular weight=342.299 }} | ||
+ | {{#set: common name=α-1,3-glucose disaccharide|sakebiose|3-O-α-D-glucopyranosyl-D-glucopyranose}} | ||
+ | {{#set: consumed by=RXN0-5395}} |
Revision as of 21:23, 17 March 2018
Contents
Metabolite 3-BETA-D-GLUCOSYLGLUCOSE
- smiles:
- C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)
- inchi key:
- InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N
- common name:
- nigerose
- molecular weight:
- 342.299
- Synonym(s):
- α-1,3-glucose disaccharide
- sakebiose
- 3-O-α-D-glucopyranosyl-D-glucopyranose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links