Difference between revisions of "Ec-19 004320"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12270 RXN-12270] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycosyl hydrolase, family...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17382 CPD-17382] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17382 CPD-17382] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=DRQAURCKCKDINZ-KPYXOPPTSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** (3R)-hydroxy-tetracosapentaenoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 1120.05 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA | ||
+ | ** (3R)-hydroxy-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA | ||
+ | ** (3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-16130]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16129]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551545 72551545] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76462 76462] |
− | {{#set: | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
− | + | {{#set: inchi key=InChIKey=DRQAURCKCKDINZ-KPYXOPPTSA-J}} | |
− | {{#set: | + | {{#set: common name=(3R)-hydroxy-tetracosapentaenoyl-CoA}} |
− | {{#set: | + | {{#set: molecular weight=1120.05 }} |
− | {{#set: | + | {{#set: common name=(3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA|(3R)-hydroxy-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA|(3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-16130}} |
− | {{#set: | + | {{#set: produced by=RXN-16129}} |
− | {{#set: | + |
Revision as of 22:24, 17 March 2018
Contents
Metabolite CPD-17382
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=DRQAURCKCKDINZ-KPYXOPPTSA-J
- common name:
- (3R)-hydroxy-tetracosapentaenoyl-CoA
- molecular weight:
- 1120.05
- Synonym(s):
- (3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA
- (3R)-hydroxy-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA
- (3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.